|
CAS#: 106639-28-5 Product: Copper(2+) Bis{(6Z)-2-Hydroxy-6-[(Hydroxyamino)Methylene]-3-Oxo-1,4-Cyclohexadien-1-Olate} No suppilers available for the product. |
| Name | Copper(2+) Bis{(6Z)-2-Hydroxy-6-[(Hydroxyamino)Methylene]-3-Oxo-1,4-Cyclohexadien-1-Olate} |
|---|---|
| Synonyms | Bis(2,3,4-trihydroxybenzaldoxyimato)copper(II); Copper, b |
| Molecular Structure | ![]() |
| Molecular Formula | C14H12CuN2O8 |
| Molecular Weight | 399.80 |
| CAS Registry Number | 106639-28-5 |
| SMILES | [Cu+2].[O-]C=1\C(\C=C/C(=O)C=1O)=C/NO.[O-]C=1/C(=C\NO)/C=C\C(=O)C=1O |
| InChI | 1S/2C7H7NO4.Cu/c2*9-5-2-1-4(3-8-12)6(10)7(5)11;/h2*1-3,8,10-12H;/q;;+2/p-2/b2*4-3-; |
| InChIKey | HQPSCKYSOXQNET-FDGPNNRMSA-L |
| Boiling point | 265.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 114.5°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Copper(2+) Bis{(6Z)-2-Hydroxy-6-[(Hydroxyamino)Methylene]-3-Oxo-1,4-Cyclohexadien-1-Olate} |