|
CAS#: 1067-90-9 Product: 4-Diethoxyphosphorylbutan-2-One No suppilers available for the product. |
| Name | 4-Diethoxyphosphorylbutan-2-One |
|---|---|
| Synonyms | Diethyl (3-Oxobutyl)Phosphonate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H17O4P |
| Molecular Weight | 208.19 |
| CAS Registry Number | 1067-90-9 |
| SMILES | C([P](OCC)(OCC)=O)CC(C)=O |
| InChI | 1S/C8H17O4P/c1-4-11-13(10,12-5-2)7-6-8(3)9/h4-7H2,1-3H3 |
| InChIKey | JTQRTGRGGCXPMU-UHFFFAOYSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 292.102°C at 760 mmHg (Cal.) |
| Flash point | 144.373°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Diethoxyphosphorylbutan-2-One |