|
CAS#: 106760-47-8 Product: (4R,5R)-4,5-Dimethyl-1,3-Dithiolane-2-Carbonyl Chloride No suppilers available for the product. |
| Name | (4R,5R)-4,5-Dimethyl-1,3-Dithiolane-2-Carbonyl Chloride |
|---|---|
| Synonyms | (4R,5R)-4,5-dimethyl-1,3-dithiolane-2-carbonyl chloride |
| Molecular Structure | ![]() |
| Molecular Formula | C6H9ClOS2 |
| Molecular Weight | 196.72 |
| CAS Registry Number | 106760-47-8 |
| SMILES | C[C@H]1S[C@@H](S[C@@H]1C)C(=O)Cl |
| InChI | 1S/C6H9ClOS2/c1-3-4(2)10-6(9-3)5(7)8/h3-4,6H,1-2H3/t3-,4-/m1/s1 |
| InChIKey | VYQBFMUHAIBYLF-QWWZWVQMSA-N |
| Density | 1.279g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.032°C at 760 mmHg (Cal.) |
| Flash point | 114.088°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4R,5R)-4,5-Dimethyl-1,3-Dithiolane-2-Carbonyl Chloride |