|
CAS#: 1069-03-0 Product: 4,5,6,7,8-Pentahydroxy-2-Oxooctanoic Acid No suppilers available for the product. |
| Name | 4,5,6,7,8-Pentahydroxy-2-Oxooctanoic Acid |
|---|---|
| Synonyms | 4,5,6,7,8-Pentahydroxy-2-Oxo-Octanoic Acid; 4,5,6,7,8-Pentahydroxy-2-Keto-Caprylic Acid; 2-Dehydro-3-Deoxy-D-Octonate |
| Molecular Structure | ![]() |
| Molecular Formula | C8H14O8 |
| Molecular Weight | 238.19 |
| CAS Registry Number | 1069-03-0 |
| SMILES | C(C(C(C(C(CO)O)O)O)O)C(C(O)=O)=O |
| InChI | 1S/C8H14O8/c9-2-5(12)7(14)6(13)3(10)1-4(11)8(15)16/h3,5-7,9-10,12-14H,1-2H2,(H,15,16) |
| InChIKey | KYQCXUMVJGMDNG-UHFFFAOYSA-N |
| Density | 1.685g/cm3 (Cal.) |
|---|---|
| Boiling point | 621.688°C at 760 mmHg (Cal.) |
| Flash point | 343.799°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5,6,7,8-Pentahydroxy-2-Oxooctanoic Acid |