|
CAS#: 1069-58-5 Product: Triethylammonium maleate No suppilers available for the product. |
| Name | Triethylammonium maleate |
|---|---|
| Synonyms | But-2-Enedioic Acid; Triethylamine; Triethylammonium Maleate |
| Molecular Structure | ![]() |
| Molecular Formula | C10H19NO4 |
| Molecular Weight | 217.26 |
| CAS Registry Number | 1069-58-5 |
| EINECS | 213-960-2 |
| SMILES | O=C(O)\C=C/C(=O)O.C(N(CC)CC)C |
| InChI | 1S/C6H15N.C4H4O4/c1-4-7(5-2)6-3;5-3(6)1-2-4(7)8/h4-6H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | BGBNXIKULUCCOO-BTJKTKAUSA-N |
| Boiling point | 355.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 183°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triethylammonium maleate |