|
CAS#: 107-50-6 Product: 2,2,4,4,6,6,8,8,10,10,12,12,14,14-Tetradecamethyl-1,3,5,7,9,11,13-Heptaoxa-2,4,6,8,10,12,14-Heptasilacyclotetradecane No suppilers available for the product. |
| Name | 2,2,4,4,6,6,8,8,10,10,12,12,14,14-Tetradecamethyl-1,3,5,7,9,11,13-Heptaoxa-2,4,6,8,10,12,14-Heptasilacyclotetradecane |
|---|---|
| Synonyms | Cycloheptasiloxane, Tetradecamethyl-; 2,2,4,4,6,6,8,8,10,10,12,12,14,14-Tetradecamethylcycloheptasiloxane |
| Molecular Structure | ![]() |
| Molecular Formula | C14H42O7Si7 |
| Molecular Weight | 519.08 |
| CAS Registry Number | 107-50-6 |
| EINECS | 203-496-9 |
| SMILES | C[Si]1(O[Si](O[Si](O[Si](O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)(C)C)(C)C)(C)C)C |
| InChI | 1S/C14H42O7Si7/c1-22(2)15-23(3,4)17-25(7,8)19-27(11,12)21-28(13,14)20-26(9,10)18-24(5,6)16-22/h1-14H3 |
| InChIKey | GSANOGQCVHBHIF-UHFFFAOYSA-N |
| Density | 0.975g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.536°C at 760 mmHg (Cal.) |
| Flash point | 150.733°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,2,4,4,6,6,8,8,10,10,12,12,14,14-Tetradecamethyl-1,3,5,7,9,11,13-Heptaoxa-2,4,6,8,10,12,14-Heptasilacyclotetradecane |