|
CAS#: 107052-56-2 Product: 4-(((8beta)-9,10-Didehydro-6-Methylergolin-8-Yl)Methyl)-2,6-Piperazinedione No suppilers available for the product. |
| Name | 4-(((8beta)-9,10-Didehydro-6-Methylergolin-8-Yl)Methyl)-2,6-Piperazinedione |
|---|---|
| Synonyms | 4-((9,10-Didehydro-6-Methylergolin-8Beta-Yl)Methyl)-2,6-Piperazinedione; Fce 23884; Romergoline |
| Molecular Structure | ![]() |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 |
| CAS Registry Number | 107052-56-2 |
| SMILES | [C@@H]25C(=C[C@@H](CN1CC(NC(C1)=O)=O)CN2C)C3=CC=CC4=C3C(=C[NH]4)C5 |
| InChI | 1S/C20H22N4O2/c1-23-8-12(9-24-10-18(25)22-19(26)11-24)5-15-14-3-2-4-16-20(14)13(7-21-16)6-17(15)23/h2-5,7,12,17,21H,6,8-11H2,1H3,(H,22,25,26)/t12-,17-/m1/s1 |
| InChIKey | RJCXNCSJGRUWRW-SJKOYZFVSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 629.704°C at 760 mmHg (Cal.) |
| Flash point | 334.633°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(((8beta)-9,10-Didehydro-6-Methylergolin-8-Yl)Methyl)-2,6-Piperazinedione |