|
CAS#: 107096-52-6 Product: 2-Methyl-6-Nitrobenzaldehyde No suppilers available for the product. |
| Name | 2-Methyl-6-Nitrobenzaldehyde |
|---|---|
| Synonyms | 2-methyl-6-nitrobenzaldehyde |
| Molecular Structure | ![]() |
| Molecular Formula | C8H7NO3 |
| Molecular Weight | 165.15 |
| CAS Registry Number | 107096-52-6 |
| SMILES | O=Cc1c(cccc1C)[N+]([O-])=O |
| InChI | 1S/C8H7NO3/c1-6-3-2-4-8(9(11)12)7(6)5-10/h2-5H,1H3 |
| InChIKey | LBHWNZFYCKTRFN-UHFFFAOYSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 307.553°C at 760 mmHg (Cal.) |
| Flash point | 153.546°C (Cal.) |
| Refractive index | 1.603 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-6-Nitrobenzaldehyde |