|
CAS#: 107320-38-7 Product: 2-(4-Methylfuran-2-Yl)Cyclohexa-2,5-Diene-1,4-Dione No suppilers available for the product. |
| Name | 2-(4-Methylfuran-2-Yl)Cyclohexa-2,5-Diene-1,4-Dione |
|---|---|
| Synonyms | 2-(4-Methyl-2-Furyl)-1,4-Benzoquinone; 2-(4-Methyl-2-Furyl)-P-Benzoquinone; 2,5-Cyclohexadiene-1,4-Dione, 2-(4-Methyl-2-Furanyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8O3 |
| Molecular Weight | 188.18 |
| CAS Registry Number | 107320-38-7 |
| SMILES | C2=C(C1=CC(C=CC1=O)=O)OC=C2C |
| InChI | 1S/C11H8O3/c1-7-4-11(14-6-7)9-5-8(12)2-3-10(9)13/h2-6H,1H3 |
| InChIKey | WFZJBXHYSHGECR-UHFFFAOYSA-N |
| Density | 1.278g/cm3 (Cal.) |
|---|---|
| Boiling point | 323.515°C at 760 mmHg (Cal.) |
| Flash point | 149.814°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Methylfuran-2-Yl)Cyclohexa-2,5-Diene-1,4-Dione |