|
CAS#: 107369-99-3 Product: 3,8,9,10,11,12-Hexahydro-2,4,9-Trimethyl-Pyrido(3',4':4,5)Pyrrolo(2,3-g)-1,5-Benzodiazepine No suppilers available for the product. |
| Name | 3,8,9,10,11,12-Hexahydro-2,4,9-Trimethyl-Pyrido(3',4':4,5)Pyrrolo(2,3-g)-1,5-Benzodiazepine |
|---|---|
| Synonyms | 2,4,9-Trimethyl-8,9,10,11-Tetrahydro-3H-Pyrido-(4,3-B)(1,4)Diazepine(2,3-G)Indole; Brn 5576002 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H20N4 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 107369-99-3 |
| SMILES | C2=C3C(=C1N=C(CC(=NC1=C2)C)C)[NH]C4=C3CN(CC4)C |
| InChI | 1S/C17H20N4/c1-10-8-11(2)19-17-15(18-10)5-4-12-13-9-21(3)7-6-14(13)20-16(12)17/h4-5,20H,6-9H2,1-3H3 |
| InChIKey | OBGCEHRBOHPYDW-UHFFFAOYSA-N |
| Density | 1.307g/cm3 (Cal.) |
|---|---|
| Boiling point | 460.436°C at 760 mmHg (Cal.) |
| Flash point | 232.264°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,8,9,10,11,12-Hexahydro-2,4,9-Trimethyl-Pyrido(3',4':4,5)Pyrrolo(2,3-g)-1,5-Benzodiazepine |