|
CAS#: 107573-16-0 Product: Benzoylphenylalanyllysine fluoromethane No suppilers available for the product. |
| Name | Benzoylphenylalanyllysine fluoromethane |
|---|---|
| Synonyms | (2S)-6-Amino-2-[[(2S)-2-Benzamido-3-Phenyl-Propanoyl]Amino]Hexanoic Acid; Fluoromethane; (2S)-6-Amino-2-[[(2S)-2-Benzamido-1-Oxo-3-Phenylpropyl]Amino]Hexanoic Acid; Fluoromethane; Benzoylphenylalanyllysine Fluoromethane |
| Molecular Structure | ![]() |
| Molecular Formula | C23H30FN3O4 |
| Molecular Weight | 431.51 |
| CAS Registry Number | 107573-16-0 |
| SMILES | [C@@H](NC(=O)C1=CC=CC=C1)(C(=O)N[C@H](C(=O)O)CCCCN)CC2=CC=CC=C2.CF |
| InChI | 1S/C22H27N3O4.CH3F/c23-14-8-7-13-18(22(28)29)24-21(27)19(15-16-9-3-1-4-10-16)25-20(26)17-11-5-2-6-12-17;1-2/h1-6,9-12,18-19H,7-8,13-15,23H2,(H,24,27)(H,25,26)(H,28,29);1H3/t18-,19-;/m0./s1 |
| InChIKey | NKPXSGPTWCLCIR-HLRBRJAUSA-N |
| Boiling point | 739.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 401.2°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benzoylphenylalanyllysine fluoromethane |