|
CAS#: 1076-46-6 Product: Azanium 3-Amino-2,5-Dichlorobenzoate No suppilers available for the product. |
| Name | Azanium 3-Amino-2,5-Dichlorobenzoate |
|---|---|
| Synonyms | Ammonium 3-Amino-2,5-Dichloro-Benzoate; Ammonium 3-Amino-2,5-Dichlorobenzoate; Azanium 3-Amino-2,5-Dichloro-Benzoate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8Cl2N2O2 |
| Molecular Weight | 223.06 |
| CAS Registry Number | 1076-46-6 |
| EINECS | 214-062-3 |
| SMILES | C1=C(Cl)C=C(N)C(=C1C([O-])=O)Cl.[NH4+] |
| InChI | 1S/C7H5Cl2NO2.H3N/c8-3-1-4(7(11)12)6(9)5(10)2-3;/h1-2H,10H2,(H,11,12);1H3 |
| InChIKey | RSSKZIYCSDAOJD-UHFFFAOYSA-N |
| Boiling point | 373.2°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 179.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Azanium 3-Amino-2,5-Dichlorobenzoate |