|
CAS#: 107817-60-7 Product: 4,9-Dihydroxy-6,7-Dimethoxybenzo[f][1,3]Benzodioxole-5,8-Dione No suppilers available for the product. |
| Name | 4,9-Dihydroxy-6,7-Dimethoxybenzo[f][1,3]Benzodioxole-5,8-Dione |
|---|---|
| Synonyms | 4,9-Dihydroxy-6,7-Dimethoxy-Benzo[F][1,3]Benzodioxole-5,8-Dione; 4,9-Dihydroxy-6,7-Dimethoxy-Benzo[F][1,3]Benzodioxole-5,8-Quinone; Tricrozarin A |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10O8 |
| Molecular Weight | 294.22 |
| CAS Registry Number | 107817-60-7 |
| SMILES | COC3=C(OC)C(=O)C2=C(C(=C1OCOC1=C2O)O)C3=O |
| InChI | 1S/C13H10O8/c1-18-10-6(14)4-5(7(15)11(10)19-2)9(17)13-12(8(4)16)20-3-21-13/h16-17H,3H2,1-2H3 |
| InChIKey | RKJCLPSFLUKWQY-UHFFFAOYSA-N |
| Density | 1.71g/cm3 (Cal.) |
|---|---|
| Boiling point | 647.977°C at 760 mmHg (Cal.) |
| Flash point | 253.923°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,9-Dihydroxy-6,7-Dimethoxybenzo[f][1,3]Benzodioxole-5,8-Dione |