|
CAS#: 1079-96-5 Product: 1,3-Di(Butan-2-Yl)Benzene No suppilers available for the product. |
| Name | 1,3-Di(Butan-2-Yl)Benzene |
|---|---|
| Synonyms | 1,3-Disec-Butylbenzene; Benzene, 1,3-Bis(1-Methylpropyl)-; M-Di(Sec-Butyl)Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 |
| CAS Registry Number | 1079-96-5 |
| SMILES | C1=CC(=CC(=C1)C(CC)C)C(CC)C |
| InChI | 1S/C14H22/c1-5-11(3)13-8-7-9-14(10-13)12(4)6-2/h7-12H,5-6H2,1-4H3 |
| InChIKey | SGJNVYYELDBNLA-UHFFFAOYSA-N |
| Density | 0.855g/cm3 (Cal.) |
|---|---|
| Boiling point | 238.738°C at 760 mmHg (Cal.) |
| Flash point | 95.024°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3-Di(Butan-2-Yl)Benzene |