|
CAS#: 108354-43-4 Product: 1,5-Bis(Oxiran-2-Yl)Pentane-1,2,3,4,5-Pentol No suppilers available for the product. |
| Name | 1,5-Bis(Oxiran-2-Yl)Pentane-1,2,3,4,5-Pentol |
|---|---|
| Synonyms | 1,5-Bis(2-Oxiranyl)Pentane-1,2,3,4,5-Pentol; 1,2,3,4,5-Pentanepentanol, 1,5-Dioxiranyl-; 1,5-Dioxiranyl-1,2,3,4,5-Pentanepentanol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H16O7 |
| Molecular Weight | 236.22 |
| CAS Registry Number | 108354-43-4 |
| SMILES | C2C(C(O)C(O)C(O)C(O)C(O)C1CO1)O2 |
| InChI | 1S/C9H16O7/c10-5(3-1-15-3)7(12)9(14)8(13)6(11)4-2-16-4/h3-14H,1-2H2 |
| InChIKey | LUCBFMMOZUJPIX-UHFFFAOYSA-N |
| Density | 1.732g/cm3 (Cal.) |
|---|---|
| Boiling point | 604.647°C at 760 mmHg (Cal.) |
| Flash point | 319.479°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,5-Bis(Oxiran-2-Yl)Pentane-1,2,3,4,5-Pentol |