|
CAS#: 1085-84-3 Product: 9-Benzyl-9-Azaspiro[5.5]Undecane Hydrochloride No suppilers available for the product. |
| Name | 9-Benzyl-9-Azaspiro[5.5]Undecane Hydrochloride |
|---|---|
| Synonyms | 9-(Phenylmethyl)-9-Azaspiro[5.5]Undecane Hydrochloride; 3-Benzyl-3-Azaspiro(5.5)Undecane Hydrochloride |
| Molecular Structure | ![]() |
| Molecular Formula | C17H26ClN |
| Molecular Weight | 279.85 |
| CAS Registry Number | 1085-84-3 |
| EINECS | 214-117-1 |
| SMILES | [H+].C3=C(CN1CCC2(CC1)CCCCC2)C=CC=C3.[Cl-] |
| InChI | 1S/C17H25N.ClH/c1-3-7-16(8-4-1)15-18-13-11-17(12-14-18)9-5-2-6-10-17;/h1,3-4,7-8H,2,5-6,9-15H2;1H |
| InChIKey | CJZHVBQUTWNTNC-UHFFFAOYSA-N |
| Boiling point | 344.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 146.7°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Benzyl-9-Azaspiro[5.5]Undecane Hydrochloride |