|
CAS#: 108536-24-9 Product: N-[(Z)-2-(2,5-Dihydroxyphenyl)Ethenyl]Formamide No suppilers available for the product. |
| Name | N-[(Z)-2-(2,5-Dihydroxyphenyl)Ethenyl]Formamide |
|---|---|
| Synonyms | N-[(Z)-2-(2,5-Dihydroxyphenyl)Vinyl]Formamide; N-[(Z)-2-(2,5-Dihydroxyphenyl)Ethenyl]Methanamide; Formamide, N-((1Z)-2-(2,5-Dihydroxyphenyl)Ethenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 |
| CAS Registry Number | 108536-24-9 |
| SMILES | C1=C(C(=CC=C1O)O)\C=C/NC=O |
| InChI | 1S/C9H9NO3/c11-6-10-4-3-7-5-8(12)1-2-9(7)13/h1-6,12-13H,(H,10,11)/b4-3- |
| InChIKey | SIHZWGODIRRSRA-ARJAWSKDSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 517.549°C at 760 mmHg (Cal.) |
| Flash point | 266.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[(Z)-2-(2,5-Dihydroxyphenyl)Ethenyl]Formamide |