|
CAS#: 108789-49-7 Product: (4aS,4bS,10bS,12aS)-8-methoxy-2,2,12a-trimethyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-chrysen-1-one No suppilers available for the product. |
| Name | (4aS,4bS,10bS,12aS)-8-methoxy-2,2,12a-trimethyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-chrysen-1-one |
|---|---|
| Synonyms | 16,16-Dimethyl-D-Homo-8-Isoestrone Methyl Ester; D-Homoestra-1,3,5(10)-Trien-17A-One, 3-Methoxy-17,17-Dimethyl-, (8Alpha)-(+-)-; Dmhiem |
| Molecular Structure | ![]() |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 |
| CAS Registry Number | 108789-49-7 |
| SMILES | [C@@H]23C1=CC=C(C=C1CC[C@@H]2[C@H]4[C@](CC3)(C(C(CC4)(C)C)=O)C)OC |
| InChI | 1S/C22H30O2/c1-21(2)11-10-19-18-7-5-14-13-15(24-4)6-8-16(14)17(18)9-12-22(19,3)20(21)23/h6,8,13,17-19H,5,7,9-12H2,1-4H3/t17-,18+,19+,22+/m1/s1 |
| InChIKey | BRSVRATYZSQLNA-GHDARCQNSA-N |
| Density | 1.04g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.363°C at 760 mmHg (Cal.) |
| Flash point | 179.441°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4aS,4bS,10bS,12aS)-8-methoxy-2,2,12a-trimethyl-4,4a,4b,5,6,10b,11,12-octahydro-3H-chrysen-1-one |