|
CAS#: 109216-58-2 Product: 1-Methyl-N-(8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl)-1H-Indazole-3-Carboxamide No suppilers available for the product. |
| Name | 1-Methyl-N-(8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl)-1H-Indazole-3-Carboxamide |
|---|---|
| Synonyms | (graniset |
| Molecular Structure | ![]() |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.38 |
| CAS Registry Number | 109216-58-2 |
| SMILES | CN1[C@@H]2CC[C@H]1C[C@@H](C2)NC(=O)C3=NN(C4=CC=CC=C43)C |
| InChI | 1S/C17H22N4O/c1-20-12-7-8-13(20)10-11(9-12)18-17(22)16-14-5-3-4-6-15(14)21(2)19-16/h3-6,11-13H,7-10H2,1-2H3,(H,18,22) |
| InChIKey | DDHAJFBBJWHSBR-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 522.2±40.0°C at 760 mmHg (Cal.) |
| Flash point | 269.6±27.3°C (Cal.) |
| Refractive index | 1.707 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methyl-N-(8-Methyl-8-Azabicyclo[3.2.1]Oct-3-Yl)-1H-Indazole-3-Carboxamide |