|
CAS#: 109523-96-8 Product: 2'-Chloro-4-(diethylaminoacetoxymethyl)biphenyl hydrogen maleate No suppilers available for the product. |
| Name | 2'-Chloro-4-(diethylaminoacetoxymethyl)biphenyl hydrogen maleate |
|---|---|
| Synonyms | But-2-Enedioic Acid; 2-Diethylaminoacetic Acid [4-(2-Chlorophenyl)Phenyl]Methyl Ester; But-2-Enedioic Acid; 2-Diethylaminoacetic Acid [4-(2-Chlorophenyl)Benzyl] Ester; But-2-Enedioic Acid; [4-(2-Chlorophenyl)Phenyl]Methyl 2-Diethylaminoethanoate |
| Molecular Structure | ![]() |
| Molecular Formula | C23H26ClNO6 |
| Molecular Weight | 447.91 |
| CAS Registry Number | 109523-96-8 |
| SMILES | C2=C(C1=CC=CC=C1Cl)C=CC(=C2)COC(=O)CN(CC)CC.O=C(O)\C=C\C(=O)O |
| InChI | 1S/C19H22ClNO2.C4H4O4/c1-3-21(4-2)13-19(22)23-14-15-9-11-16(12-10-15)17-7-5-6-8-18(17)20;5-3(6)1-2-4(7)8/h5-12H,3-4,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | AOSZXXPVOQMXAB-WLHGVMLRSA-N |
| Market Analysis Reports |
| List of Reports Available for 2'-Chloro-4-(diethylaminoacetoxymethyl)biphenyl hydrogen maleate |