|
CAS#: 110271-21-1 Product: (4E,10Z,16bS)-7,14,16-Tribromo-5-Chloro-6,9-Dihydro-9,9-Dimethylazeto[1',2':1,2]Imidazo[4',5':7,8]Azecino[3,2-b]Indole-2(1H)-One No suppilers available for the product. |
| Name | (4E,10Z,16bS)-7,14,16-Tribromo-5-Chloro-6,9-Dihydro-9,9-Dimethylazeto[1',2':1,2]Imidazo[4',5':7,8]Azecino[3,2-b]Indole-2(1H)-One |
|---|---|
| Synonyms | chartelline B |
| Molecular Structure | ![]() |
| Molecular Formula | C20H14Br3ClN4O |
| Molecular Weight | 601.52 |
| CAS Registry Number | 110271-21-1 |
| SMILES | CC3(C)\C=C/C5=N/c1cc(Br)cc(Br)c1C54CC(=O)N4/C=C(/Cl)c2nc(Br)nc23 |
| InChI | 1S/C20H14Br3ClN4O/c1-19(2)4-3-13-20(15-10(22)5-9(21)6-12(15)25-13)7-14(29)28(20)8-11(24)16-17(19)27-18(23)26-16/h3-6,8H,7H2,1-2H3,(H,26,27)/b4-3-,11-8+ |
| InChIKey | HMFWDXIIQSKMGY-PRTWDDKSSA-N |
| Density | 2.074g/cm3 (Cal.) |
|---|---|
| Boiling point | 743.307°C at 760 mmHg (Cal.) |
| Flash point | 403.338°C (Cal.) |
| Refractive index | 1.799 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (4E,10Z,16bS)-7,14,16-Tribromo-5-Chloro-6,9-Dihydro-9,9-Dimethylazeto[1',2':1,2]Imidazo[4',5':7,8]Azecino[3,2-b]Indole-2(1H)-One |