|
CAS#: 11031-82-6 Product: Streptovaricin B No suppilers available for the product. |
| Name | Streptovaricin B |
|---|---|
| Synonyms | Streptovaricin B; Nsc 156215; Nsc 189794 |
| Molecular Structure | ![]() |
| Molecular Formula | C42H53NO15 |
| Molecular Weight | 811.88 |
| CAS Registry Number | 11031-82-6 |
| SMILES | [C@@H]1([C@H](OC(=O)C)[C@@H]([C@@H](O)[C@@](O)(C)\C=C(C4=C3C2=C(OC(=O)C)C(=C(NC(=O)C(=C\C=C/[C@H](C(O)[C@H]([C@H]1O)C)C)\C)C(=O)C2=C(O)C(=C3OCO4)C)C)\C)C)C(OC)=O |
| InChI | 1S/C42H53NO15/c1-17-13-12-14-18(2)40(51)43-30-20(4)37(57-24(8)44)26-27(34(30)49)33(48)22(6)36-28(26)35(55-16-56-36)19(3)15-42(10,53)39(50)23(7)38(58-25(9)45)29(41(52)54-11)32(47)21(5)31(17)46/h12-15,17,21,23,29,31-32,38-39,46-48,50,53H,16H2,1-11H3,(H,43,51)/b13-12-,18-14+,19-15-/t17-,21-,23+,29-,31?,32-,38-,39-,42-/m1/s1 |
| InChIKey | OFTBCJGFYRLYFS-LAEFYEGWSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 933.7±65.0°C at 760 mmHg (Cal.) |
| Flash point | 518.5±34.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Streptovaricin B |