|
CAS#: 110383-42-1 Product: Carbonodithioic Acid, O-Tricyclo(6.2.1.13,6)Dodec-4-Yl Ester, Sodium Salt No suppilers available for the product. |
| Name | Carbonodithioic Acid, O-Tricyclo(6.2.1.13,6)Dodec-4-Yl Ester, Sodium Salt |
|---|---|
| Synonyms | Cyclodecyl Xanthogenate; D 435; D-435 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20NaOS2 |
| Molecular Weight | 279.41 |
| CAS Registry Number | 110383-42-1 |
| SMILES | C(S)(=S)OC3C1CC(CC2CC(C1)CC2)C3.[Na+] |
| InChI | 1S/C13H20OS2.Na/c15-13(16)14-12-7-10-4-8-1-2-9(3-8)5-11(12)6-10;/h8-12H,1-7H2,(H,15,16);/q;+1 |
| InChIKey | JEOCMLUTANRVCM-UHFFFAOYSA-N |
| Boiling point | 339.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 158.9°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Carbonodithioic Acid, O-Tricyclo(6.2.1.13,6)Dodec-4-Yl Ester, Sodium Salt |