|
CAS#: 110504-77-3 Product: 4',6-Diamino-3-Biphenylol No suppilers available for the product. |
| Name | 4',6-Diamino-3-Biphenylol |
|---|---|
| Synonyms | NSC229368 |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 |
| CAS Registry Number | 110504-77-3 |
| SMILES | Oc2cc(c1ccc(N)cc1)c(N)cc2 |
| InChI | 1S/C12H12N2O/c13-9-3-1-8(2-4-9)11-7-10(15)5-6-12(11)14/h1-7,15H,13-14H2 |
| InChIKey | GAERKXWXVVOXTE-UHFFFAOYSA-N |
| Density | 1.27g/cm3 (Cal.) |
|---|---|
| Boiling point | 438.831°C at 760 mmHg (Cal.) |
| Flash point | 219.197°C (Cal.) |
| Refractive index | 1.704 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4',6-Diamino-3-Biphenylol |