|
CAS#: 110559-65-4 Product: [2-Methyl-2-(4-Methylpent-3-Enyl)Cyclopropyl]Methyl Phosphono Hydrogen Phosphate No suppilers available for the product. |
| Name | [2-Methyl-2-(4-Methylpent-3-Enyl)Cyclopropyl]Methyl Phosphono Hydrogen Phosphate |
|---|---|
| Synonyms | 2,3-Cpgpp; 2,3-Cyclopropylgeranyl Pyrophosphate; Diphosphoric, Mono((2-Methyl-2-(4-Methyl-3-Pentenyl)Cyclopropyl)Methyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C11H22O7P2 |
| Molecular Weight | 328.24 |
| CAS Registry Number | 110559-65-4 |
| SMILES | C(O[P](O[P](=O)(O)O)(=O)O)C1C(C1)(CCC=C(C)C)C |
| InChI | 1S/C11H22O7P2/c1-9(2)5-4-6-11(3)7-10(11)8-17-20(15,16)18-19(12,13)14/h5,10H,4,6-8H2,1-3H3,(H,15,16)(H2,12,13,14) |
| InChIKey | QEONFRSBRCWSGB-UHFFFAOYSA-N |
| Density | 1.349g/cm3 (Cal.) |
|---|---|
| Boiling point | 468.764°C at 760 mmHg (Cal.) |
| Flash point | 237.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [2-Methyl-2-(4-Methylpent-3-Enyl)Cyclopropyl]Methyl Phosphono Hydrogen Phosphate |