|
CAS#: 110901-84-3 Product: 3-[(1S,2R)-2-(Dipropylamino)Cyclopropyl]Phenol No suppilers available for the product. |
| Name | 3-[(1S,2R)-2-(Dipropylamino)Cyclopropyl]Phenol |
|---|---|
| Synonyms | 2-(3-Hydroxyphenyl)-N,N-Di-N-Propylcyclopropylamine; 3-Oh-Dpca; Phenol, 3-(2-(Dipropylamino)Cyclopropyl)-, (1S-Trans)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H23NO |
| Molecular Weight | 233.35 |
| CAS Registry Number | 110901-84-3 |
| SMILES | [C@@H]1([C@H](N(CCC)CCC)C1)C2=CC(=CC=C2)O |
| InChI | 1S/C15H23NO/c1-3-8-16(9-4-2)15-11-14(15)12-6-5-7-13(17)10-12/h5-7,10,14-15,17H,3-4,8-9,11H2,1-2H3/t14-,15+/m0/s1 |
| InChIKey | SGAIAYHFAITRSL-LSDHHAIUSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.699°C at 760 mmHg (Cal.) |
| Flash point | 159.633°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-[(1S,2R)-2-(Dipropylamino)Cyclopropyl]Phenol |