|
CAS#: 1111-02-0 Product: Tetrakis(Pentafluorophenyl)Plumbane No suppilers available for the product. |
| Name | Tetrakis(Pentafluorophenyl)Plumbane |
|---|---|
| Synonyms | Nsc168731; Plumbane, Tetrakis(Pentafluorophenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C24F20Pb |
| Molecular Weight | 875.43 |
| CAS Registry Number | 1111-02-0 |
| SMILES | C1(=C(F)C(=C(F)C(=C1F)F)F)[Pb](C2=C(F)C(=C(F)C(=C2F)F)F)(C3=C(F)C(=C(F)C(=C3F)F)F)C4=C(F)C(=C(F)C(=C4F)F)F |
| InChI | 1S/4C6F5.Pb/c4*7-2-1-3(8)5(10)6(11)4(2)9; |
| InChIKey | NIZVWYJQMRLKOH-UHFFFAOYSA-N |
| Boiling point | 476.211°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 241.804°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Tetrakis(Pentafluorophenyl)Plumbane |