|
CAS#: 111130-87-1 Product: Phenyl 1-Hydroxy-5-[(Isobutoxycarbonyl)Amino]-2-Naphthoate No suppilers available for the product. |
| Name | Phenyl 1-Hydroxy-5-[(Isobutoxycarbonyl)Amino]-2-Naphthoate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H21NO5 |
| Molecular Weight | 379.41 |
| CAS Registry Number | 111130-87-1 |
| SMILES | O=C(Oc1ccccc1)c3ccc2c(NC(=O)OCC(C)C)cccc2c3O |
| InChI | 1S/C22H21NO5/c1-14(2)13-27-22(26)23-19-10-6-9-17-16(19)11-12-18(20(17)24)21(25)28-15-7-4-3-5-8-15/h3-12,14,24H,13H2,1-2H3,(H,23,26) |
| InChIKey | AVXGZOSFTCLSHE-UHFFFAOYSA-N |
| Density | 1.287g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.835°C at 760 mmHg (Cal.) |
| Flash point | 259.72°C (Cal.) |
| Refractive index | 1.649 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl 1-Hydroxy-5-[(Isobutoxycarbonyl)Amino]-2-Naphthoate |