|
CAS#: 1113-14-0 Product: 1-[(Z)-2-Propylsulfonylethenyl]Sulfonylpropane No suppilers available for the product. |
| Name | 1-[(Z)-2-Propylsulfonylethenyl]Sulfonylpropane |
|---|---|
| Synonyms | 1-[(Z)-2-Propylsulfonylvinyl]Sulfonylpropane; Nsc68091; Propane, 1,1'-[1,2-Ethenediylbis(Sulfonyl)]Bis-, (E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C8H16O4S2 |
| Molecular Weight | 240.33 |
| CAS Registry Number | 1113-14-0 |
| EINECS | 214-200-2 |
| SMILES | C(CC)[S](\C=C/[S](CCC)(=O)=O)(=O)=O |
| InChI | 1S/C8H16O4S2/c1-3-5-13(9,10)7-8-14(11,12)6-4-2/h7-8H,3-6H2,1-2H3/b8-7- |
| InChIKey | YTPMCWYIRHLEGM-FPLPWBNLSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.017°C at 760 mmHg (Cal.) |
| Flash point | 290.567°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(Z)-2-Propylsulfonylethenyl]Sulfonylpropane |