|
CAS#: 111509-09-2 Product: Lepedine No suppilers available for the product. |
| Name | Lepedine |
|---|---|
| Synonyms | 7,20-Cycl |
| Molecular Structure | ![]() |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.53 |
| CAS Registry Number | 111509-09-2 |
| SMILES | O[C@@H]6/C(=C)[C@@H]5CCC26[C@H](C14[C@@H]3N(CC)CC([C@@H]1C[C@@H]23)(C)CC[C@@H]4OC)[C@H]5O |
| InChI | 1S/C23H35NO3/c1-5-24-11-21(3)8-7-16(27-4)23-15(21)10-14(19(23)24)22-9-6-13(12(2)20(22)26)17(25)18(22)23/h13-20,25-26H,2,5-11H2,1,3-4H3/t13-,14+,15-,16-,17-,18+,19+,20+,21?,22?,23?/m0/s1 |
| InChIKey | XXZZJNAAUWXZNM-NAQBOWBQSA-N |
| Density | 1.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 508.17°C at 760 mmHg (Cal.) |
| Flash point | 261.132°C (Cal.) |
| Refractive index | 1.608 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Lepedine |