|
CAS#: 111532-65-1 Product: Zinc (2-Ethenoxyethylamino)Methanedithioate No suppilers available for the product. |
| Name | Zinc (2-Ethenoxyethylamino)Methanedithioate |
|---|---|
| Synonyms | Bis((2-(Ethenyloxy)Ethyl)Carbamodithioato-S,S')Zinc (T-4); Zinc, Bis((2-(Ethenyloxy)Ethyl)Carbamodithioato-S,S')-, (T-4)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16N2O2S4Zn |
| Molecular Weight | 389.87 |
| CAS Registry Number | 111532-65-1 |
| SMILES | C(NC([S-])=S)COC=C.C(NC([S-])=S)COC=C.[Zn++] |
| InChI | 1S/2C5H9NOS2.Zn/c2*1-2-7-4-3-6-5(8)9;/h2*2H,1,3-4H2,(H2,6,8,9);/q;;+2/p-2 |
| InChIKey | PEDMCIJHVORARS-UHFFFAOYSA-L |
| Boiling point | 217.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 85.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Zinc (2-Ethenoxyethylamino)Methanedithioate |