|
CAS#: 111821-21-7 Product: [(1S,4S)-1,7,7-Trimethyl-6-Bicyclo[2.2.1]Heptanyl] Prop-2-Enoate No suppilers available for the product. |
| Name | [(1S,4S)-1,7,7-Trimethyl-6-Bicyclo[2.2.1]Heptanyl] Prop-2-Enoate |
|---|---|
| Synonyms | [(1S,4S)-1,7,7-Trimethylnorbornan-2-Yl] Prop-2-Enoate; Prop-2-Enoic Acid [(1S,4S)-1,7,7-Trimethyl-2-Norbornanyl] Ester; 2-Propenoic Acid, (1R,2R,4R)-1,7,7-Trimethylbicyclo(2.2.1)Hept-2-Ylester, Rel- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 |
| CAS Registry Number | 111821-21-7 |
| SMILES | [C@@H]12CC([C@](CC1)(C)C2(C)C)OC(C=C)=O |
| InChI | 1S/C13H20O2/c1-5-11(14)15-10-8-9-6-7-13(10,4)12(9,2)3/h5,9-10H,1,6-8H2,2-4H3/t9-,10?,13+/m0/s1 |
| InChIKey | PSGCQDPCAWOCSH-BOURZNODSA-N |
| Density | 1.009g/cm3 (Cal.) |
|---|---|
| Boiling point | 244.535°C at 760 mmHg (Cal.) |
| Flash point | 94.636°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1S,4S)-1,7,7-Trimethyl-6-Bicyclo[2.2.1]Heptanyl] Prop-2-Enoate |