|
CAS#: 112112-58-0 Product: 9-Methylene-[3.3.3]Propellane-2,8-Dione No suppilers available for the product. |
| Name | 9-Methylene-[3.3.3]Propellane-2,8-Dione |
|---|---|
| Synonyms | (3.3.3)-Propellane-2,8-Dione, 9-Methylene- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 |
| CAS Registry Number | 112112-58-0 |
| SMILES | O=C2C13C(CCC1=C)(CC2)CCC3=O |
| InChI | 1S/C12H14O2/c1-8-2-5-11-6-3-9(13)12(8,11)10(14)4-7-11/h1-7H2 |
| InChIKey | XOUFDVRLVGVXSP-UHFFFAOYSA-N |
| Density | 1.184g/cm3 (Cal.) |
|---|---|
| Boiling point | 354.017°C at 760 mmHg (Cal.) |
| Flash point | 132.83°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Methylene-[3.3.3]Propellane-2,8-Dione |