|
CAS#: 112426-34-3 Product: Bis(eta5-2,3,4-Trimethylpenta-2,4-Dien-1-Yl)-Iron No suppilers available for the product. |
| Name | Bis(eta5-2,3,4-Trimethylpenta-2,4-Dien-1-Yl)-Iron |
|---|---|
| Synonyms | Iron, bis(η5-2,3,4-trimethylpenta-2,4-dien-1-yl)-; Iron, bis(η5-2,3,4-trimethylpenta-2,4-dien-1-yl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H26Fe |
| Molecular Weight | 274.23 |
| CAS Registry Number | 112426-34-3 |
| SMILES | [Fe].[CH2-][C-]([C-]([C-]([CH2-])C)C)C.[CH2-][C-]([C-]([C-]([CH2-])C)C)C |
| InChI | 1S/2C8H13.Fe/c2*1-6(2)8(5)7(3)4;/h2*1,3H2,2,4-5H3;/q2*-5; |
| InChIKey | SOEVXARCEAUXOI-UHFFFAOYSA-N |
| Boiling point | 113.5°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 5°C (Cal.) |
| Refractive index | (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Bis(eta5-2,3,4-Trimethylpenta-2,4-Dien-1-Yl)-Iron |