Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink massive supplier since 2012 | ||||
| Name | Furconazole |
|---|---|
| Synonyms | Furconazole [Iso:Bsi] |
| Molecular Structure |  |
| Molecular Formula | C15H14Cl2F3N3O2 |
| Molecular Weight | 396.20 |
| CAS Registry Number | 112839-33-5 |
| SMILES | C1=N[N](C=N1)CC2(OC(CC2)OCC(F)(F)F)C3=CC=C(C=C3Cl)Cl |
| InChI | 1S/C15H14Cl2F3N3O2/c16-10-1-2-11(12(17)5-10)14(6-23-9-21-8-22-23)4-3-13(25-14)24-7-15(18,19)20/h1-2,5,8-9,13H,3-4,6-7H2 |
| InChIKey | ULCWZQJLFZEXCS-UHFFFAOYSA-N |
| Density | 1.525g/cm3 (Cal.) |
|---|---|
| Boiling point | 489.918°C at 760 mmHg (Cal.) |
| Flash point | 250.094°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Furconazole |