|
CAS#: 112930-60-6 Product: (3E)-3-(2-Methyl-6H-Benzo[c][1]Benzothiepin-11-Ylidene)Propanoic Acid No suppilers available for the product. |
| Name | (3E)-3-(2-Methyl-6H-Benzo[c][1]Benzothiepin-11-Ylidene)Propanoic Acid |
|---|---|
| Synonyms | 3-(2-Methyl-6H-Benzo[C][1]Benzothiepin-11-Ylidene)Propanoic Acid; 3-(2-Methyl-6H-Benzo[C][1]Benzothiepin-11-Ylidene)Propionic Acid; (3E)-3-(2-Methyl-6H-Benzo[C][1]Benzothiepin-11-Ylidene)Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C18H16O2S |
| Molecular Weight | 296.38 |
| CAS Registry Number | 112930-60-6 |
| SMILES | C3=C2\C(C1=CC=CC=C1CSC2=CC=C3C)=C\CC(=O)O |
| InChI | 1S/C18H16O2S/c1-12-6-8-17-16(10-12)15(7-9-18(19)20)14-5-3-2-4-13(14)11-21-17/h2-8,10H,9,11H2,1H3,(H,19,20)/b15-7+ |
| InChIKey | SSTKQFGZJJOWGS-VIZOYTHASA-N |
| Density | 1.3g/cm3 (Cal.) |
|---|---|
| Boiling point | 518.333°C at 760 mmHg (Cal.) |
| Flash point | 267.278°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3E)-3-(2-Methyl-6H-Benzo[c][1]Benzothiepin-11-Ylidene)Propanoic Acid |