|
CAS#: 1130-18-3 Product: 3,3-Diethyl-1-Methyl-2,4(1H,3H)-Pyridinedione No suppilers available for the product. |
| Name | 3,3-Diethyl-1-Methyl-2,4(1H,3H)-Pyridinedione |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 |
| CAS Registry Number | 1130-18-3 |
| SMILES | O=C1N(C)/C=C\C(=O)C1(CC)CC |
| InChI | 1S/C10H15NO2/c1-4-10(5-2)8(12)6-7-11(3)9(10)13/h6-7H,4-5H2,1-3H3 |
| InChIKey | PMYYZHNRRDQBLH-UHFFFAOYSA-N |
| Density | 1.022g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.098°C at 760 mmHg (Cal.) |
| Flash point | 128.378°C (Cal.) |
| Refractive index | 1.473 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Diethyl-1-Methyl-2,4(1H,3H)-Pyridinedione |