|
CAS#: 113122-50-2 Product: Myrocin C No suppilers available for the product. |
| Name | Myrocin C |
|---|---|
| Synonyms | 3H-Cyclopropa(4,4A)Phenanthro(10,1-Bc)Furan-3,5(1H)-Dione, 7-Ethenyl-2,2A,4A,7,8,9,9A,9C,10,10A-Decahydro-4A,9A-Dihydroxy-2A,7-Dimethyl-, (2Aalpha,4Aalpha,7Alpha,9Aalpha,9Br*,9Calpha,10Aalpha)-(+)-; Myrocin C |
| Molecular Structure | ![]() |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 |
| CAS Registry Number | 113122-50-2 |
| SMILES | CC25C4C1(C(C1)CC2)C3C(=CC(CC3)(C=C)C)C(=O)C4(OC5=O)O |
| InChI | 1S/C20H24O4/c1-4-17(2)7-6-13-12(10-17)14(21)20(23)15-18(3,16(22)24-20)8-5-11-9-19(11,13)15/h4,10-11,13,15,23H,1,5-9H2,2-3H3 |
| InChIKey | YENFFEBXHXPBJD-UHFFFAOYSA-N |
| Density | 1.299g/cm3 (Cal.) |
|---|---|
| Boiling point | 526.662°C at 760 mmHg (Cal.) |
| Flash point | 190.277°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Myrocin C |