|
CAS#: 113276-92-9 Product: S-(2-Bromophenyl)Mercapturic Acid No suppilers available for the product. |
| Name | S-(2-Bromophenyl)Mercapturic Acid |
|---|---|
| Synonyms | (2R)-2-Acetamido-3-(2-Bromophenyl)Sulfanyl-Propanoic Acid; (2R)-2-Acetamido-3-[(2-Bromophenyl)Thio]Propanoic Acid; (2R)-2-Acetamido-3-[(2-Bromophenyl)Thio]Propionic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12BrNO3S |
| Molecular Weight | 318.18 |
| CAS Registry Number | 113276-92-9 |
| SMILES | [C@H](C(=O)O)(NC(=O)C)CSC1=CC=CC=C1Br |
| InChI | 1S/C11H12BrNO3S/c1-7(14)13-9(11(15)16)6-17-10-5-3-2-4-8(10)12/h2-5,9H,6H2,1H3,(H,13,14)(H,15,16)/t9-/m0/s1 |
| InChIKey | BCEPAWKGKVEGSZ-VIFPVBQESA-N |
| Density | 1.597g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.186°C at 760 mmHg (Cal.) |
| Flash point | 270.213°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-(2-Bromophenyl)Mercapturic Acid |