|
CAS#: 113361-36-7 Product: 8-Ethoxy-7-Methylquinoline-5,6-Dione No suppilers available for the product. |
| Name | 8-Ethoxy-7-Methylquinoline-5,6-Dione |
|---|---|
| Synonyms | 8-Ethoxy-7-Methyl-Quinoline-5,6-Dione; 8-Ethoxy-7-Methyl-Quinoline-5,6-Quinone; 8-Ethoxy-7-Methyl-5,6-Dihydroquinoline-5,6-Dione |
| Molecular Structure | ![]() |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 |
| CAS Registry Number | 113361-36-7 |
| SMILES | C1=C2C(=NC=C1)C(=C(C(=O)C2=O)C)OCC |
| InChI | 1S/C12H11NO3/c1-3-16-12-7(2)10(14)11(15)8-5-4-6-13-9(8)12/h4-6H,3H2,1-2H3 |
| InChIKey | FXKOKNWZODELNW-UHFFFAOYSA-N |
| Density | 1.262g/cm3 (Cal.) |
|---|---|
| Boiling point | 392.805°C at 760 mmHg (Cal.) |
| Flash point | 191.362°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Ethoxy-7-Methylquinoline-5,6-Dione |