|
CAS#: 1134-85-6 Product: Ammonium 2-Amino-4,6-Dinitrophenolate No suppilers available for the product. |
| Name | Ammonium 2-Amino-4,6-Dinitrophenolate |
|---|---|
| Synonyms | Ammonium 2-Amino-4,6-Dinitro-Phenolate; Ammonium 2-Amino-4,6-Dinitrophenolate; Azanium 2-Amino-4,6-Dinitro-Phenolate |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8N4O5 |
| Molecular Weight | 216.15 |
| CAS Registry Number | 1134-85-6 |
| EINECS | 214-487-4 |
| SMILES | C1=C([N+]([O-])=O)C(=C(N)C=C1[N+]([O-])=O)[O-].[NH4+] |
| InChI | 1S/C6H5N3O5.H3N/c7-4-1-3(8(11)12)2-5(6(4)10)9(13)14;/h1-2,10H,7H2;1H3 |
| InChIKey | QVQATLCZPOLIEI-UHFFFAOYSA-N |
| Boiling point | 386.3°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 187.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ammonium 2-Amino-4,6-Dinitrophenolate |