|
CAS#: 113473-32-8 Product: [(1S,5R)-6,6-Dimethyl-4-Oxobicyclo[3.1.1]Hept-2-En-2-Yl]Methyl Pivalate No suppilers available for the product. |
| Name | [(1S,5R)-6,6-Dimethyl-4-Oxobicyclo[3.1.1]Hept-2-En-2-Yl]Methyl Pivalate |
|---|---|
| Synonyms | ZINC00057108 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.33 |
| CAS Registry Number | 113473-32-8 |
| SMILES | O=C1\C=C(/[C@H]2C[C@@H]1C2(C)C)COC(=O)C(C)(C)C |
| InChI | 1S/C15H22O3/c1-14(2,3)13(17)18-8-9-6-12(16)11-7-10(9)15(11,4)5/h6,10-11H,7-8H2,1-5H3/t10-,11+/m1/s1 |
| InChIKey | NJIUSKQTOGHXSZ-MNOVXSKESA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 334.468°C at 760 mmHg (Cal.) |
| Flash point | 143.669°C (Cal.) |
| Refractive index | 1.49 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for [(1S,5R)-6,6-Dimethyl-4-Oxobicyclo[3.1.1]Hept-2-En-2-Yl]Methyl Pivalate |