Online Database of Chemicals from Around the World
|
CAS#: 1136-94-3 Product: 6-Bromoamiloride No suppilers available for the product. |
| Name | 6-Bromoamiloride |
|---|---|
| Synonyms | 3,5-Diamino-6-Bromo-N-(Diaminomethylene)Pyrazine-2-Carboxamide; 3,5-Diamino-6-Bromo-N-(Diaminomethylene)-2-Pyrazinecarboxamide; 3,5-Diamino-6-Bromo-N-(Diaminomethylene)Pyrazinamide |
| Molecular Structure |  |
| Molecular Formula | C6H8BrN7O |
| Molecular Weight | 274.08 |
| CAS Registry Number | 1136-94-3 |
| SMILES | C1(=C(N=C(N)C(=N1)Br)N)C(=O)N=C(N)N |
| InChI | 1S/C6H8BrN7O/c7-2-4(9)13-3(8)1(12-2)5(15)14-6(10)11/h(H4,8,9,13)(H4,10,11,14,15) |
| InChIKey | BHMQVZXIGQOCNL-UHFFFAOYSA-N |
| Density | 2.451g/cm3 (Cal.) |
|---|---|
| Boiling point | 612.712°C at 760 mmHg (Cal.) |
| Flash point | 324.357°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-Bromoamiloride |