|
CAS#: 1138-47-2 Product: (trans)-1,1'-(1,2-Cyclopropanediyl)Bisbenzene No suppilers available for the product. |
| Name | (trans)-1,1'-(1,2-Cyclopropanediyl)Bisbenzene |
|---|---|
| Synonyms | 1,2-Diphenylcyclopropane, Trans-; Benzene, 1,1'-(1,2-Cyclopropanediyl)Bis-, Trans-; Cyclopropane, 1,2-Diphenyl-, Trans- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 |
| CAS Registry Number | 1138-47-2 |
| EINECS | 214-511-3 |
| SMILES | [C@H]1([C@H](C1)C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C15H14/c1-3-7-12(8-4-1)14-11-15(14)13-9-5-2-6-10-13/h1-10,14-15H,11H2/t14-,15-/m1/s1 |
| InChIKey | ZSIYTDQNAOYUNE-HUUCEWRRSA-N |
| Density | 1.07g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.6°C at 760 mmHg (Cal.) |
| Flash point | 130.766°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (trans)-1,1'-(1,2-Cyclopropanediyl)Bisbenzene |