| Name | 3-(2-Chloroethyl)-4-Oxo-3H-Imidazo(5,1-d)-1,2,3,5-Tetrazine-8-Carboxylic Acid |
|---|---|
| Synonyms | 3-(2-Chloroethyl)-4-Oxo-Imidazo[5,1-D][1,2,3,5]Tetrazine-8-Carboxylic Acid; 3-(2-Chloroethyl)-4-Oxo-8-Imidazo[5,1-D][1,2,3,5]Tetrazinecarboxylic Acid; 3-(2-Chloroethyl)-4-Keto-Imidazo[5,1-D][1,2,3,5]Tetrazine-8-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C7H6ClN5O3 |
| Molecular Weight | 243.61 |
| CAS Registry Number | 113942-32-8 |
| SMILES | C1=NC(=C2[N]1C(N(CCCl)N=N2)=O)C(O)=O |
| InChI | 1S/C7H6ClN5O3/c8-1-2-13-7(16)12-3-9-4(6(14)15)5(12)10-11-13/h3H,1-2H2,(H,14,15) |
| InChIKey | FOGTXLLWVRUBDH-UHFFFAOYSA-N |
| Density | 1.946g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.575°C at 760 mmHg (Cal.) |
| Flash point | 269.239°C (Cal.) |
| (1) | P. R. Lowe and C. H. Schwalbe. 8-Acid Derivative of the Antitumour Agent Mitozolomide, Acta Cryst. (1995). C51, 937-939 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(2-Chloroethyl)-4-Oxo-3H-Imidazo(5,1-d)-1,2,3,5-Tetrazine-8-Carboxylic Acid |