|
CAS#: 114-27-2 Product: 5,6,7,8-Tetrahydro-6,7-Dimethylpteridine No suppilers available for the product. |
| Name | 5,6,7,8-Tetrahydro-6,7-Dimethylpteridine |
|---|---|
| Synonyms | 5,6,7,8-Tetrahydro-6,7-Dimethylpteridine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 |
| CAS Registry Number | 114-27-2 |
| EINECS | 204-044-3 |
| SMILES | C1=C2C(=NC=N1)NC(C)C(N2)C |
| InChI | 1S/C8H12N4/c1-5-6(2)12-8-7(11-5)3-9-4-10-8/h3-6,11H,1-2H3,(H,9,10,12) |
| InChIKey | CALVHBWWYCZXKE-UHFFFAOYSA-N |
| Density | 1.061g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.251°C at 760 mmHg (Cal.) |
| Flash point | 151.716°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5,6,7,8-Tetrahydro-6,7-Dimethylpteridine |