|
CAS#: 114088-58-3 Product: 9-((2-Phosphonylmethoxy)Ethyl)Guanine No suppilers available for the product. |
| Name | 9-((2-Phosphonylmethoxy)Ethyl)Guanine |
|---|---|
| Synonyms | 2-(2-Amino-6-Keto-3H-Purin-9-Yl)Ethoxymethylphosphonic Acid; Aids-111814; 9-((2-Phosphonylmethoxy)Ethyl)Guanine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H12N5O5P |
| Molecular Weight | 289.19 |
| CAS Registry Number | 114088-58-3 |
| SMILES | C2=NC1=C(NC(=NC1=O)N)[N]2CCOC[P](O)(=O)O |
| InChI | 1S/C8H12N5O5P/c9-8-11-6-5(7(14)12-8)10-3-13(6)1-2-18-4-19(15,16)17/h3H,1-2,4H2,(H2,15,16,17)(H3,9,11,12,14) |
| InChIKey | NZVORGQIEFTOQZ-UHFFFAOYSA-N |
| Density | 2.033g/cm3 (Cal.) |
|---|---|
| Boiling point | 726.474°C at 760 mmHg (Cal.) |
| Flash point | 393.157°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-((2-Phosphonylmethoxy)Ethyl)Guanine |