|
CAS#: 1141-37-3 Product: 4-[Bis(2-Chloroethyl)Amino]Benzoic Acid No suppilers available for the product. |
| Name | 4-[Bis(2-Chloroethyl)Amino]Benzoic Acid |
|---|---|
| Synonyms | 4-(Bis(2-Chloroethyl)Amino)Benzoic Acid; 4-14-00-01170 (Beilstein Handbook Reference); 4-N-Bis(2-Chloroethyl)Aminobenzoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13Cl2NO2 |
| Molecular Weight | 262.14 |
| CAS Registry Number | 1141-37-3 |
| SMILES | C1=C(C=CC(=C1)N(CCCl)CCCl)C(O)=O |
| InChI | 1S/C11H13Cl2NO2/c12-5-7-14(8-6-13)10-3-1-9(2-4-10)11(15)16/h1-4H,5-8H2,(H,15,16) |
| InChIKey | PCLQMXVMRDPVKX-UHFFFAOYSA-N |
| Density | 1.339g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.565°C at 760 mmHg (Cal.) |
| Flash point | 211.779°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Bis(2-Chloroethyl)Amino]Benzoic Acid |