|
CAS#: 1143-46-0 Product: 1-[(1S,2R,3R)-2-(3-Isopropyl-2-Furyl)-3-Methylcyclopentyl]Ethanone No suppilers available for the product. |
| Name | 1-[(1S,2R,3R)-2-(3-Isopropyl-2-Furyl)-3-Methylcyclopentyl]Ethanone |
|---|---|
| Synonyms | furopelargone B |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33 |
| CAS Registry Number | 1143-46-0 |
| SMILES | CC(C)c2ccoc2[C@@H]1[C@H](C)CC[C@@H]1C(C)=O |
| InChI | 1S/C15H22O2/c1-9(2)12-7-8-17-15(12)14-10(3)5-6-13(14)11(4)16/h7-10,13-14H,5-6H2,1-4H3/t10-,13-,14-/m1/s1 |
| InChIKey | DVIZGXBTTFXQQC-LERXQTSPSA-N |
| Density | 0.989g/cm3 (Cal.) |
|---|---|
| Boiling point | 314.984°C at 760 mmHg (Cal.) |
| Flash point | 145.117°C (Cal.) |
| Refractive index | 1.485 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(1S,2R,3R)-2-(3-Isopropyl-2-Furyl)-3-Methylcyclopentyl]Ethanone |