|
CAS#: 114394-01-3 Product: Urodiolenone No suppilers available for the product. |
| Name | Urodiolenone |
|---|---|
| Synonyms | (4R,4As)-6-[(1R)-1,2-Dihydroxy-1-Methyl-Ethyl]-4,4A-Dimethyl-3,4,5,6,7,8-Hexahydronaphthalen-2-One; (4R,4As)-6-[(1R)-1,2-Dihydroxy-1-Methylethyl]-4,4A-Dimethyl-3,4,5,6,7,8-Hexahydronaphthalen-2-One; 2(3H)-Naphthalenone, 6-(1,2-Dihydroxy-1-Methylethyl)-4,4A,5,6,7,8-Hexahydro-4,4A-Dimethyl-, (4R-(4Alpha,4Aalpha,6Beta(*)))- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 |
| CAS Registry Number | 114394-01-3 |
| SMILES | [C@]12(C(=CC(=O)C[C@H]1C)CCC(C2)[C@@](O)(CO)C)C |
| InChI | 1S/C15H24O3/c1-10-6-13(17)7-11-4-5-12(8-14(10,11)2)15(3,18)9-16/h7,10,12,16,18H,4-6,8-9H2,1-3H3/t10-,12?,14+,15+/m1/s1 |
| InChIKey | DJPISZPEZJGKKI-NLNMXKJXSA-N |
| Density | 1.118g/cm3 (Cal.) |
|---|---|
| Boiling point | 423.089°C at 760 mmHg (Cal.) |
| Flash point | 223.822°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Urodiolenone |